C20H31IO — CID 66641644
1-[(1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]prop-2-en-1-ol (PubChem CID 66641644) has the molecular formula C20H31IO and a molecular weight of 414.37 g/mol. Its IUPAC name is 1-[(1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]prop-2-en-1-ol.
| Compound Name | 1-[(1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 66641644 |
| Molecular Formula | C20H31IO |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-[(1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthren-1-yl]prop-2-en-1-ol |
| SMILES | C=CC(O)[C@]1(C)CCC[C@@]2(C)C3=CCC[C@](C)(I)C3CCC12 |
| InChI | InChI=1S/C20H31IO/c1-5-17(22)19(3)12-7-11-18(2)14-8-6-13-20(4,21)15(14)9-10-16(18)19/h5,8,15-17,22H,1,6-7,9-13H2,2-4H3/t15?,16?,17?,18-,19+,20-/m0/s1 |
| InChIKey | YSVPSVMCCUKZDZ-YVXUSEISSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|