C18H27IO — CID 87087239
(1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde (PubChem CID 87087239) has the molecular formula C18H27IO and a molecular weight of 386.32 g/mol. Its IUPAC name is (1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde.
| Compound Name | (1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde |
|---|---|
| PubChem CID | 87087239 |
| Molecular Formula | C18H27IO |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (1R,4aR,8S)-8-iodo-1,4a,8-trimethyl-3,4,6,7,8a,9,10,10a-octahydro-2H-phenanthrene-1-carbaldehyde |
| SMILES | C[C@]1(I)CCC=C2C1CCC1[C@@]2(C)CCC[C@@]1(C)C=O |
| InChI | InChI=1S/C18H27IO/c1-16(12-20)9-5-10-17(2)13-6-4-11-18(3,19)14(13)7-8-15(16)17/h6,12,14-15H,4-5,7-11H2,1-3H3/t14?,15?,16-,17-,18-/m0/s1 |
| InChIKey | LRQARPKTKDMFTF-CNFALQKSSA-N |
| XLogP | 5.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|