C19H32O2 — CID 11109108
(1S,5S,6R,8aS)-5-(3-hydroxy-3-methylbutyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbaldehyde (PubChem CID 11109108) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is (1S,5S,6R,8aS)-5-(3-hydroxy-3-methylbutyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbaldehyde.
| Compound Name | (1S,5S,6R,8aS)-5-(3-hydroxy-3-methylbutyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 11109108 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | (1S,5S,6R,8aS)-5-(3-hydroxy-3-methylbutyl)-1,5,6-trimethyl-2,3,6,7,8,8a-hexahydronaphthalene-1-carbaldehyde |
| SMILES | C[C@@H]1CC[C@H]2C(=CCC[C@]2(C)C=O)[C@@]1(C)CCC(C)(C)O |
| InChI | InChI=1S/C19H32O2/c1-14-8-9-15-16(7-6-10-18(15,4)13-20)19(14,5)12-11-17(2,3)21/h7,13-15,21H,6,8-12H2,1-5H3/t14-,15+,18-,19+/m1/s1 |
| InChIKey | RKAMLXUZFKCTKP-OHQAAIJDSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|