C29H38O4 — CID 162884184
1,5,6-trimethyl-5-[3-methyl-5-(3-phenylprop-2-enoyloxy)pent-3-enyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid (PubChem CID 162884184) has the molecular formula C29H38O4 and a molecular weight of 450.62 g/mol. Its IUPAC name is 1,5,6-trimethyl-5-[3-methyl-5-(3-phenylprop-2-enoyloxy)pent-3-enyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid.
| Compound Name | 1,5,6-trimethyl-5-[3-methyl-5-(3-phenylprop-2-enoyloxy)pent-3-enyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 162884184 |
| Molecular Formula | C29H38O4 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | 1,5,6-trimethyl-5-[3-methyl-5-(3-phenylprop-2-enoyloxy)pent-3-enyl]-2,3,6,7,8,8a-hexahydronaphthalene-1-carboxylic acid |
| SMILES | CC(=CCOC(=O)C=Cc1ccccc1)CCC1(C)C2=CCCC(C)(C(=O)O)C2CCC1C |
| InChI | InChI=1S/C29H38O4/c1-21(17-20-33-26(30)15-13-23-9-6-5-7-10-23)16-19-28(3)22(2)12-14-25-24(28)11-8-18-29(25,4)27(31)32/h5-7,9-11,13,15,17,22,25H,8,12,14,16,18-20H2,1-4H3,(H,31,32) |
| InChIKey | GMJGSZHZLYBXRY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|