C20H34O — CID 162955836
(3S)-5-[(1R,6R)-1,6-dimethyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]-3-methylpent-1-en-3-ol (PubChem CID 162955836) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is (3S)-5-[(1R,6R)-1,6-dimethyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]-3-methylpent-1-en-3-ol.
| Compound Name | (3S)-5-[(1R,6R)-1,6-dimethyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]-3-methylpent-1-en-3-ol |
|---|---|
| PubChem CID | 162955836 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | (3S)-5-[(1R,6R)-1,6-dimethyl-2-(4-methylpent-3-enyl)cyclohex-2-en-1-yl]-3-methylpent-1-en-3-ol |
| SMILES | C=C[C@@](C)(O)CC[C@@]1(C)C(CCC=C(C)C)=CCC[C@H]1C |
| InChI | InChI=1S/C20H34O/c1-7-19(5,21)14-15-20(6)17(4)11-9-13-18(20)12-8-10-16(2)3/h7,10,13,17,21H,1,8-9,11-12,14-15H2,2-6H3/t17-,19-,20-/m1/s1 |
| InChIKey | DETJKMZPBXGPIT-MISYRCLQSA-N |
| XLogP | 5.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|