C27H46O — CID 161369183
3-[(E)-4,6-dimethylhept-3-enyl]furan;(5S,6S)-6-(2,2-dimethylpropyl)-1,5,6-trimethylcyclohexene (PubChem CID 161369183) has the molecular formula C27H46O and a molecular weight of 386.66 g/mol. Its IUPAC name is 3-[(E)-4,6-dimethylhept-3-enyl]furan;(5S,6S)-6-(2,2-dimethylpropyl)-1,5,6-trimethylcyclohexene.
| Compound Name | 3-[(E)-4,6-dimethylhept-3-enyl]furan;(5S,6S)-6-(2,2-dimethylpropyl)-1,5,6-trimethylcyclohexene |
|---|---|
| PubChem CID | 161369183 |
| Molecular Formula | C27H46O |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 386.35 |
| IUPAC Name | 3-[(E)-4,6-dimethylhept-3-enyl]furan;(5S,6S)-6-(2,2-dimethylpropyl)-1,5,6-trimethylcyclohexene |
| SMILES | C/C(=C\CCc1ccoc1)CC(C)C.CC1=CCC[C@H](C)[C@]1(C)CC(C)(C)C |
| InChI | InChI=1S/C14H26.C13H20O/c1-11-8-7-9-12(2)14(11,6)10-13(3,4)5;1-11(2)9-12(3)5-4-6-13-7-8-14-10-13/h8,12H,7,9-10H2,1-6H3;5,7-8,10-11H,4,6,9H2,1-3H3/b;12-5+/t12-,14+;/m0./s1 |
| InChIKey | VQFSQRQEVNAGNX-SKUFNFPBSA-N |
| XLogP | 9.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|