C20H30O — CID 132987739
3-[2-[(1R,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]furan (PubChem CID 132987739) has the molecular formula C20H30O and a molecular weight of 286.46 g/mol. Its IUPAC name is 3-[2-[(1R,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]furan.
| Compound Name | 3-[2-[(1R,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]furan |
|---|---|
| PubChem CID | 132987739 |
| Molecular Formula | C20H30O |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | 3-[2-[(1R,2R,4aR,8aS)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]furan |
| SMILES | CC1=CCC[C@H]2[C@](C)(CCc3ccoc3)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C20H30O/c1-15-6-5-7-18-19(15,3)11-8-16(2)20(18,4)12-9-17-10-13-21-14-17/h6,10,13-14,16,18H,5,7-9,11-12H2,1-4H3/t16-,18-,19+,20-/m1/s1 |
| InChIKey | IVBOCAVCEPSFAH-RSPOEFSDSA-N |
| XLogP | 6.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|