C23H32O6 — CID 163009994
3-[[8-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-7,8-dimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methoxy]-3-oxopropanoic acid (PubChem CID 163009994) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-[[8-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-7,8-dimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methoxy]-3-oxopropanoic acid.
| Compound Name | 3-[[8-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-7,8-dimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methoxy]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 163009994 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 3-[[8-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-7,8-dimethyl-1,2,5,6,7,8a-hexahydronaphthalen-4a-yl]methoxy]-3-oxopropanoic acid |
| SMILES | CC1CCC2(COC(=O)CC(=O)O)C(CO)=CCCC2C1(C)CCc1ccoc1 |
| InChI | InChI=1S/C23H32O6/c1-16-6-10-23(15-29-21(27)12-20(25)26)18(13-24)4-3-5-19(23)22(16,2)9-7-17-8-11-28-14-17/h4,8,11,14,16,19,24H,3,5-7,9-10,12-13,15H2,1-2H3,(H,25,26) |
| InChIKey | IVLSJOYTYVWEHN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|