C22H34O5 — CID 162871015
[(2R,3R,4R,4aR,7R,8S,8aR)-8-[2-(furan-3-yl)ethyl]-3,4-dihydroxy-4,4a,7,8-tetramethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl] acetate (PubChem CID 162871015) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(2R,3R,4R,4aR,7R,8S,8aR)-8-[2-(furan-3-yl)ethyl]-3,4-dihydroxy-4,4a,7,8-tetramethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl] acetate.
| Compound Name | [(2R,3R,4R,4aR,7R,8S,8aR)-8-[2-(furan-3-yl)ethyl]-3,4-dihydroxy-4,4a,7,8-tetramethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl] acetate |
|---|---|
| PubChem CID | 162871015 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(2R,3R,4R,4aR,7R,8S,8aR)-8-[2-(furan-3-yl)ethyl]-3,4-dihydroxy-4,4a,7,8-tetramethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2[C@@](C)(CCc3ccoc3)[C@H](C)CC[C@@]2(C)[C@@](C)(O)[C@@H]1O |
| InChI | InChI=1S/C22H34O5/c1-14-6-10-21(4)18(20(14,3)9-7-16-8-11-26-13-16)12-17(27-15(2)23)19(24)22(21,5)25/h8,11,13-14,17-19,24-25H,6-7,9-10,12H2,1-5H3/t14-,17-,18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | HZCWIIBLNSXKPG-WESWALGWSA-N |
| XLogP | 3.72 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |