C22H29O5- — CID 7330553
(4aS,5S,6R,8aR)-8a-(acetyloxymethyl)-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate (PubChem CID 7330553) has the molecular formula C22H29O5- and a molecular weight of 373.47 g/mol. Its IUPAC name is (4aS,5S,6R,8aR)-8a-(acetyloxymethyl)-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate.
| Compound Name | (4aS,5S,6R,8aR)-8a-(acetyloxymethyl)-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 7330553 |
| Molecular Formula | C22H29O5- |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (4aS,5S,6R,8aR)-8a-(acetyloxymethyl)-5-[2-(furan-3-yl)ethyl]-5,6-dimethyl-3,4,4a,6,7,8-hexahydronaphthalene-1-carboxylate |
| SMILES | CC(=O)OC[C@]12CC[C@@H](C)[C@](C)(CCc3ccoc3)[C@@H]1CCC=C2C(=O)[O-] |
| InChI | InChI=1S/C22H30O5/c1-15-7-11-22(14-27-16(2)23)18(20(24)25)5-4-6-19(22)21(15,3)10-8-17-9-12-26-13-17/h5,9,12-13,15,19H,4,6-8,10-11,14H2,1-3H3,(H,24,25)/p-1/t15-,19+,21+,22+/m1/s1 |
| InChIKey | AIXFHEQYDFHUMC-QTLGSODGSA-M |
| XLogP | 3.28 |
| TPSA | 79.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |