C26H36O7 — CID 162844116
[3,4-diacetyloxy-1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate (PubChem CID 162844116) has the molecular formula C26H36O7 and a molecular weight of 460.57 g/mol. Its IUPAC name is [3,4-diacetyloxy-1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate.
| Compound Name | [3,4-diacetyloxy-1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162844116 |
| Molecular Formula | C26H36O7 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | [3,4-diacetyloxy-1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1(CCc2ccoc2)C(C)C(OC(C)=O)C(OC(C)=O)C2(C)C(C)=CCCC12 |
| InChI | InChI=1S/C26H36O7/c1-16-8-7-9-22-25(16,6)24(33-20(5)29)23(32-19(4)28)17(2)26(22,15-31-18(3)27)12-10-21-11-13-30-14-21/h8,11,13-14,17,22-24H,7,9-10,12,15H2,1-6H3 |
| InChIKey | JZLBWRRSKXMEQB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|