C20H30O3 — CID 25195057
(2R,3S,4S,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-3,8,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol (PubChem CID 25195057) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (2R,3S,4S,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-3,8,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol.
| Compound Name | (2R,3S,4S,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-3,8,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 25195057 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (2R,3S,4S,4aS,8aR)-4-[2-(furan-3-yl)ethyl]-4-(hydroxymethyl)-3,8,8a-trimethyl-1,2,3,4a,5,6-hexahydronaphthalen-2-ol |
| SMILES | CC1=CCC[C@@H]2[C@@](CO)(CCc3ccoc3)[C@H](C)[C@H](O)C[C@@]12C |
| InChI | InChI=1S/C20H30O3/c1-14-5-4-6-18-19(14,3)11-17(22)15(2)20(18,13-21)9-7-16-8-10-23-12-16/h5,8,10,12,15,17-18,21-22H,4,6-7,9,11,13H2,1-3H3/t15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | DCLPBMPTOFSZFT-LFZDHENXSA-N |
| XLogP | 3.95 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|