C22H30O4 — CID 85282816
[1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 85282816) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 85282816 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [1-[2-(furan-3-yl)ethyl]-2,4a,5-trimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1(CCc2ccoc2)C(C)CCC2(C)C(C)=CC(=O)CC21 |
| InChI | InChI=1S/C22H30O4/c1-15-5-8-21(4)16(2)11-19(24)12-20(21)22(15,14-26-17(3)23)9-6-18-7-10-25-13-18/h7,10-11,13,15,20H,5-6,8-9,12,14H2,1-4H3 |
| InChIKey | XMTAIXFAMJUEAK-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |