C22H30O6 — CID 90662157
[(4R,5S,5aS,6R,7R,9aR)-5-[2-(furan-3-yl)ethyl]-4,5-dimethyl-2-oxospiro[4,5a,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-7,2'-oxirane]-6-yl]methyl acetate (PubChem CID 90662157) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is [(4R,5S,5aS,6R,7R,9aR)-5-[2-(furan-3-yl)ethyl]-4,5-dimethyl-2-oxospiro[4,5a,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-7,2'-oxirane]-6-yl]methyl acetate.
| Compound Name | [(4R,5S,5aS,6R,7R,9aR)-5-[2-(furan-3-yl)ethyl]-4,5-dimethyl-2-oxospiro[4,5a,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-7,2'-oxirane]-6-yl]methyl acetate |
|---|---|
| PubChem CID | 90662157 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [(4R,5S,5aS,6R,7R,9aR)-5-[2-(furan-3-yl)ethyl]-4,5-dimethyl-2-oxospiro[4,5a,6,8,9,9a-hexahydro-3H-benzo[b]oxepine-7,2'-oxirane]-6-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1[C@@H]2[C@@H](CC[C@]13CO3)OC(=O)C[C@@H](C)[C@]2(C)CCc1ccoc1 |
| InChI | InChI=1S/C22H30O6/c1-14-10-19(24)28-18-5-8-22(13-27-22)17(12-26-15(2)23)20(18)21(14,3)7-4-16-6-9-25-11-16/h6,9,11,14,17-18,20H,4-5,7-8,10,12-13H2,1-3H3/t14-,17+,18-,20-,21+,22+/m1/s1 |
| InChIKey | KRZVLMSVXFBWSP-YSLQSSPASA-N |
| XLogP | 3.53 |
| TPSA | 78.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|