C22H30O4 — CID 162932964
[(1R,2S,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5,8a-trimethyl-7-oxo-3,4,4a,8-tetrahydro-2H-naphthalen-1-yl]methyl acetate (PubChem CID 162932964) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is [(1R,2S,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5,8a-trimethyl-7-oxo-3,4,4a,8-tetrahydro-2H-naphthalen-1-yl]methyl acetate.
| Compound Name | [(1R,2S,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5,8a-trimethyl-7-oxo-3,4,4a,8-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 162932964 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | [(1R,2S,4aS,8aS)-1-[2-(furan-3-yl)ethyl]-2,5,8a-trimethyl-7-oxo-3,4,4a,8-tetrahydro-2H-naphthalen-1-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(CCc2ccoc2)[C@@H](C)CC[C@H]2C(C)=CC(=O)C[C@@]21C |
| InChI | InChI=1S/C22H30O4/c1-15-11-19(24)12-21(4)20(15)6-5-16(2)22(21,14-26-17(3)23)9-7-18-8-10-25-13-18/h8,10-11,13,16,20H,5-7,9,12,14H2,1-4H3/t16-,20-,21-,22+/m0/s1 |
| InChIKey | FEKNZQFDRWVNBO-IRNNPGBSSA-N |
| XLogP | 4.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |