C24H32O8 — CID 14845536
[(3S,4R,4aR,5R,7S,8R,8aR)-3-acetyloxy-8-[2-(furan-3-yl)ethyl]-5-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5,7,8a-hexahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate (PubChem CID 14845536) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is [(3S,4R,4aR,5R,7S,8R,8aR)-3-acetyloxy-8-[2-(furan-3-yl)ethyl]-5-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5,7,8a-hexahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate.
| Compound Name | [(3S,4R,4aR,5R,7S,8R,8aR)-3-acetyloxy-8-[2-(furan-3-yl)ethyl]-5-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5,7,8a-hexahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 14845536 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | [(3S,4R,4aR,5R,7S,8R,8aR)-3-acetyloxy-8-[2-(furan-3-yl)ethyl]-5-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5,7,8a-hexahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12[C@H](CC[C@H](OC(C)=O)[C@]13CO3)[C@@](C)(CCc1ccoc1)[C@H](C)C(=O)[C@@H]2O |
| InChI | InChI=1S/C24H32O8/c1-14-20(27)21(28)23(12-30-15(2)25)18(22(14,4)9-7-17-8-10-29-11-17)5-6-19(32-16(3)26)24(23)13-31-24/h8,10-11,14,18-19,21,28H,5-7,9,12-13H2,1-4H3/t14-,18-,19+,21+,22+,23+,24-/m1/s1 |
| InChIKey | GTJXDGIYMWUALM-ZGJPEDHDSA-N |
| XLogP | 2.46 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|