C28H36O12 — CID 11376460
[(3S,4R,4aR,5R,7R,8R,8aS)-3,5,7-triacetyloxy-8-[2-(furan-3-yl)ethyl]-8a-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5-tetrahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate (PubChem CID 11376460) has the molecular formula C28H36O12 and a molecular weight of 564.58 g/mol. Its IUPAC name is [(3S,4R,4aR,5R,7R,8R,8aS)-3,5,7-triacetyloxy-8-[2-(furan-3-yl)ethyl]-8a-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5-tetrahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate.
| Compound Name | [(3S,4R,4aR,5R,7R,8R,8aS)-3,5,7-triacetyloxy-8-[2-(furan-3-yl)ethyl]-8a-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5-tetrahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 11376460 |
| Molecular Formula | C28H36O12 |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | [(3S,4R,4aR,5R,7R,8R,8aS)-3,5,7-triacetyloxy-8-[2-(furan-3-yl)ethyl]-8a-hydroxy-7,8-dimethyl-6-oxospiro[1,2,3,5-tetrahydronaphthalene-4,2'-oxirane]-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12[C@@H](OC(C)=O)C(=O)[C@](C)(OC(C)=O)[C@](C)(CCc3ccoc3)[C@@]1(O)CC[C@H](OC(C)=O)[C@]21CO1 |
| InChI | InChI=1S/C28H36O12/c1-16(29)36-14-26-23(39-18(3)31)22(33)25(6,40-19(4)32)24(5,10-7-20-9-12-35-13-20)28(26,34)11-8-21(38-17(2)30)27(26)15-37-27/h9,12-13,21,23,34H,7-8,10-11,14-15H2,1-6H3/t21-,23-,24-,25-,26-,27+,28-/m0/s1 |
| InChIKey | SARUBGGLRQRORJ-JEXOSSJKSA-N |
| XLogP | 1.83 |
| TPSA | 168.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|