C26H36O8 — CID 163036168
[6,7-diacetyloxy-4-[2-(furan-3-yl)ethyl]-5,7a,7b-trimethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-4-yl]methyl acetate (PubChem CID 163036168) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is [6,7-diacetyloxy-4-[2-(furan-3-yl)ethyl]-5,7a,7b-trimethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-4-yl]methyl acetate.
| Compound Name | [6,7-diacetyloxy-4-[2-(furan-3-yl)ethyl]-5,7a,7b-trimethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-4-yl]methyl acetate |
|---|---|
| PubChem CID | 163036168 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [6,7-diacetyloxy-4-[2-(furan-3-yl)ethyl]-5,7a,7b-trimethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-4-yl]methyl acetate |
| SMILES | CC(=O)OCC1(CCc2ccoc2)C(C)C(OC(C)=O)C(OC(C)=O)C2(C)C1CCC1OC12C |
| InChI | InChI=1S/C26H36O8/c1-15-22(32-17(3)28)23(33-18(4)29)24(5)20(7-8-21-25(24,6)34-21)26(15,14-31-16(2)27)11-9-19-10-12-30-13-19/h10,12-13,15,20-23H,7-9,11,14H2,1-6H3 |
| InChIKey | PRUMRUYPEPUIQH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 104.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|