C27H36O7 — CID 156602857
[6-acetyloxy-4-[2-(furan-3-yl)-2-oxoethyl]-4,5,7a,7b-tetramethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-7-yl] 2-methylbut-2-enoate (PubChem CID 156602857) has the molecular formula C27H36O7 and a molecular weight of 472.58 g/mol. Its IUPAC name is [6-acetyloxy-4-[2-(furan-3-yl)-2-oxoethyl]-4,5,7a,7b-tetramethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-7-yl] 2-methylbut-2-enoate.
| Compound Name | [6-acetyloxy-4-[2-(furan-3-yl)-2-oxoethyl]-4,5,7a,7b-tetramethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-7-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 156602857 |
| Molecular Formula | C27H36O7 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | [6-acetyloxy-4-[2-(furan-3-yl)-2-oxoethyl]-4,5,7a,7b-tetramethyl-2,3,3a,5,6,7-hexahydro-1aH-naphtho[1,2-b]oxiren-7-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(OC(C)=O)C(C)C(C)(CC(=O)c2ccoc2)C2CCC3OC3(C)C12C |
| InChI | InChI=1S/C27H36O7/c1-8-15(2)24(30)33-23-22(32-17(4)28)16(3)25(5,13-19(29)18-11-12-31-14-18)20-9-10-21-27(7,34-21)26(20,23)6/h8,11-12,14,16,20-23H,9-10,13H2,1-7H3 |
| InChIKey | YWYBKXSCRXCWOI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 95.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|