C21H26O6 — CID 162973547
[4-formyl-4-[2-(furan-3-yl)-2-oxoethyl]-5,7a-dimethyl-1a,2,3,3a,5,6,7,7b-octahydronaphtho[1,2-b]oxiren-6-yl] acetate (PubChem CID 162973547) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is [4-formyl-4-[2-(furan-3-yl)-2-oxoethyl]-5,7a-dimethyl-1a,2,3,3a,5,6,7,7b-octahydronaphtho[1,2-b]oxiren-6-yl] acetate.
| Compound Name | [4-formyl-4-[2-(furan-3-yl)-2-oxoethyl]-5,7a-dimethyl-1a,2,3,3a,5,6,7,7b-octahydronaphtho[1,2-b]oxiren-6-yl] acetate |
|---|---|
| PubChem CID | 162973547 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [4-formyl-4-[2-(furan-3-yl)-2-oxoethyl]-5,7a-dimethyl-1a,2,3,3a,5,6,7,7b-octahydronaphtho[1,2-b]oxiren-6-yl] acetate |
| SMILES | CC(=O)OC1CC2(C)C3OC3CCC2C(C=O)(CC(=O)c2ccoc2)C1C |
| InChI | InChI=1S/C21H26O6/c1-12-17(26-13(2)23)9-20(3)18(5-4-16-19(20)27-16)21(12,11-22)8-15(24)14-6-7-25-10-14/h6-7,10-12,16-19H,4-5,8-9H2,1-3H3 |
| InChIKey | PAKQVNKBWMVVTD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 86.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|