C22H32O7 — CID 163002693
[(2R,2'S,3R,4R,4aS,5'S,7R,8R,8aS)-5'-(furan-3-yl)-2',7,8-trihydroxy-3,8,8a-trimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-4,3'-oxolane]-2-yl] acetate (PubChem CID 163002693) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is [(2R,2'S,3R,4R,4aS,5'S,7R,8R,8aS)-5'-(furan-3-yl)-2',7,8-trihydroxy-3,8,8a-trimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-4,3'-oxolane]-2-yl] acetate.
| Compound Name | [(2R,2'S,3R,4R,4aS,5'S,7R,8R,8aS)-5'-(furan-3-yl)-2',7,8-trihydroxy-3,8,8a-trimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-4,3'-oxolane]-2-yl] acetate |
|---|---|
| PubChem CID | 163002693 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | [(2R,2'S,3R,4R,4aS,5'S,7R,8R,8aS)-5'-(furan-3-yl)-2',7,8-trihydroxy-3,8,8a-trimethylspiro[2,3,4a,5,6,7-hexahydro-1H-naphthalene-4,3'-oxolane]-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@]2(C)[C@H](CC[C@@H](O)[C@]2(C)O)[C@]2(C[C@@H](c3ccoc3)O[C@@H]2O)[C@H]1C |
| InChI | InChI=1S/C22H32O7/c1-12-15(28-13(2)23)9-20(3)17(5-6-18(24)21(20,4)26)22(12)10-16(29-19(22)25)14-7-8-27-11-14/h7-8,11-12,15-19,24-26H,5-6,9-10H2,1-4H3/t12-,15+,16-,17-,18+,19-,20-,21-,22-/m0/s1 |
| InChIKey | GZVVOAJUBYETCL-FOQMRYPFSA-N |
| XLogP | 2.55 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |