C24H28O9 — CID 25228769
[(1S,4S,7R,9R,10R,12S,13R,14S)-13-acetyloxy-7-(furan-3-yl)-9-methyl-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadecan-12-yl] acetate (PubChem CID 25228769) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is [(1S,4S,7R,9R,10R,12S,13R,14S)-13-acetyloxy-7-(furan-3-yl)-9-methyl-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadecan-12-yl] acetate.
| Compound Name | [(1S,4S,7R,9R,10R,12S,13R,14S)-13-acetyloxy-7-(furan-3-yl)-9-methyl-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadecan-12-yl] acetate |
|---|---|
| PubChem CID | 25228769 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | [(1S,4S,7R,9R,10R,12S,13R,14S)-13-acetyloxy-7-(furan-3-yl)-9-methyl-5,15-dioxo-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadecan-12-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H](OC(C)=O)C[C@@H]2[C@@]3(C)C[C@H](c4ccoc4)OC(=O)[C@H]3CC[C@]23COC(=O)[C@H]13 |
| InChI | InChI=1S/C24H28O9/c1-12(25)31-16-8-18-23(3)9-17(14-5-7-29-10-14)33-21(27)15(23)4-6-24(18)11-30-22(28)19(24)20(16)32-13(2)26/h5,7,10,15-20H,4,6,8-9,11H2,1-3H3/t15-,16+,17-,18-,19+,20+,23+,24+/m1/s1 |
| InChIKey | AHIOJYDKHYCRTB-QARZRZBBSA-N |
| XLogP | 2.73 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|