C24H31NO8 — CID 70827509
[(2S,4aR,6aR,7R,9S,10bR)-2-(furan-3-yl)-7-(2-hydroxyethylcarbamoyl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] acetate (PubChem CID 70827509) has the molecular formula C24H31NO8 and a molecular weight of 461.51 g/mol. Its IUPAC name is [(2S,4aR,6aR,7R,9S,10bR)-2-(furan-3-yl)-7-(2-hydroxyethylcarbamoyl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] acetate.
| Compound Name | [(2S,4aR,6aR,7R,9S,10bR)-2-(furan-3-yl)-7-(2-hydroxyethylcarbamoyl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] acetate |
|---|---|
| PubChem CID | 70827509 |
| Molecular Formula | C24H31NO8 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [(2S,4aR,6aR,7R,9S,10bR)-2-(furan-3-yl)-7-(2-hydroxyethylcarbamoyl)-6a,10b-dimethyl-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromen-9-yl] acetate |
| SMILES | CC(=O)O[C@H]1C[C@@H](C(=O)NCCO)[C@]2(C)CC[C@H]3C(=O)O[C@H](c4ccoc4)C[C@]3(C)C2C1=O |
| InChI | InChI=1S/C24H31NO8/c1-13(27)32-17-10-16(21(29)25-7-8-26)23(2)6-4-15-22(30)33-18(14-5-9-31-12-14)11-24(15,3)20(23)19(17)28/h5,9,12,15-18,20,26H,4,6-8,10-11H2,1-3H3,(H,25,29)/t15-,16-,17-,18-,20?,23-,24-/m0/s1 |
| InChIKey | CXHYOMSAYWUVHI-AUXFCCIWSA-N |
| XLogP | 1.94 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |