C23H29NO8 — CID 46831889
methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-(methylcarbamoyloxy)-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 46831889) has the molecular formula C23H29NO8 and a molecular weight of 447.48 g/mol. Its IUPAC name is methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-(methylcarbamoyloxy)-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-(methylcarbamoyloxy)-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 46831889 |
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | methyl (2R,4aR,6aR,7R,9S,10aS,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-(methylcarbamoyloxy)-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | CNC(=O)O[C@H]1C[C@@H](C(=O)OC)[C@]2(C)CC[C@H]3C(=O)O[C@@H](c4ccoc4)C[C@]3(C)[C@H]2C1=O |
| InChI | InChI=1S/C23H29NO8/c1-22-7-5-13-20(27)31-16(12-6-8-30-11-12)10-23(13,2)18(22)17(25)15(32-21(28)24-3)9-14(22)19(26)29-4/h6,8,11,13-16,18H,5,7,9-10H2,1-4H3,(H,24,28)/t13-,14-,15-,16+,18-,22-,23-/m0/s1 |
| InChIKey | ZVDXMVLKAYBGOS-JEEZTOBCSA-N |
| XLogP | 2.79 |
| TPSA | 121.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|