C22H28O9S — CID 58969073
methyl (2S,6aR,7R,9S,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-methylsulfonyloxy-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 58969073) has the molecular formula C22H28O9S and a molecular weight of 468.52 g/mol. Its IUPAC name is methyl (2S,6aR,7R,9S,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-methylsulfonyloxy-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (2S,6aR,7R,9S,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-methylsulfonyloxy-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 58969073 |
| Molecular Formula | C22H28O9S |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | methyl (2S,6aR,7R,9S,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-9-methylsulfonyloxy-4,10-dioxo-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](OS(C)(=O)=O)C(=O)C2[C@@]3(C)C[C@@H](c4ccoc4)OC(=O)C3CC[C@]21C |
| InChI | InChI=1S/C22H28O9S/c1-21-7-5-13-20(25)30-16(12-6-8-29-11-12)10-22(13,2)18(21)17(23)15(31-32(4,26)27)9-14(21)19(24)28-3/h6,8,11,13-16,18H,5,7,9-10H2,1-4H3/t13?,14-,15-,16-,18?,21-,22-/m0/s1 |
| InChIKey | JPQCLBRBPPZECE-UQSMVXDASA-N |
| XLogP | 2.41 |
| TPSA | 126.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|