C20H28O5 — CID 163036741
(2S,4aS,6aS,7R,8S,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,7,10b-trimethyl-2,4a,5,6,8,9,10,10a-octahydro-1H-benzo[f]isochromen-4-one (PubChem CID 163036741) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (2S,4aS,6aS,7R,8S,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,7,10b-trimethyl-2,4a,5,6,8,9,10,10a-octahydro-1H-benzo[f]isochromen-4-one.
| Compound Name | (2S,4aS,6aS,7R,8S,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,7,10b-trimethyl-2,4a,5,6,8,9,10,10a-octahydro-1H-benzo[f]isochromen-4-one |
|---|---|
| PubChem CID | 163036741 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (2S,4aS,6aS,7R,8S,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,7,10b-trimethyl-2,4a,5,6,8,9,10,10a-octahydro-1H-benzo[f]isochromen-4-one |
| SMILES | C[C@]12C[C@@H](c3ccoc3)OC(=O)[C@H]1CC[C@@]1(C)[C@@H]2CC[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C20H28O5/c1-18-10-14(12-7-9-24-11-12)25-17(22)13(18)6-8-19(2)15(18)4-5-16(21)20(19,3)23/h7,9,11,13-16,21,23H,4-6,8,10H2,1-3H3/t13-,14+,15-,16+,18+,19+,20+/m1/s1 |
| InChIKey | RBEATXBLUJTDQZ-IZVMADOGSA-N |
| XLogP | 3.21 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |