C20H24O7 — CID 155809478
(2R,4aS,6aS,7S,8R,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,10b-dimethyl-4-oxo-2,4a,5,6,8,10a-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid (PubChem CID 155809478) has the molecular formula C20H24O7 and a molecular weight of 376.41 g/mol. Its IUPAC name is (2R,4aS,6aS,7S,8R,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,10b-dimethyl-4-oxo-2,4a,5,6,8,10a-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid.
| Compound Name | (2R,4aS,6aS,7S,8R,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,10b-dimethyl-4-oxo-2,4a,5,6,8,10a-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid |
|---|---|
| PubChem CID | 155809478 |
| Molecular Formula | C20H24O7 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2R,4aS,6aS,7S,8R,10aR,10bR)-2-(furan-3-yl)-7,8-dihydroxy-6a,10b-dimethyl-4-oxo-2,4a,5,6,8,10a-hexahydro-1H-benzo[f]isochromene-7-carboxylic acid |
| SMILES | C[C@]12C[C@H](c3ccoc3)OC(=O)[C@H]1CC[C@@]1(C)[C@@H]2C=C[C@@H](O)[C@]1(O)C(=O)O |
| InChI | InChI=1S/C20H24O7/c1-18-9-13(11-6-8-26-10-11)27-16(22)12(18)5-7-19(2)14(18)3-4-15(21)20(19,25)17(23)24/h3-4,6,8,10,12-15,21,25H,5,7,9H2,1-2H3,(H,23,24)/t12-,13-,14-,15-,18+,19+,20+/m1/s1 |
| InChIKey | MSBYMUALYMIOLB-GHVJSJMJSA-N |
| XLogP | 2.05 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|