C21H28O4 — CID 143111724
(6aS,7R,9S,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione (PubChem CID 143111724) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is (6aS,7R,9S,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione.
| Compound Name | (6aS,7R,9S,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione |
|---|---|
| PubChem CID | 143111724 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | (6aS,7R,9S,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione |
| SMILES | C[C@@H]1C[C@H](C)C(=O)C2[C@@]3(C)CC(c4ccoc4)OC(=O)C3CC[C@]21C |
| InChI | InChI=1S/C21H28O4/c1-12-9-13(2)20(3)7-5-15-19(23)25-16(14-6-8-24-11-14)10-21(15,4)18(20)17(12)22/h6,8,11-13,15-16,18H,5,7,9-10H2,1-4H3/t12-,13+,15?,16?,18?,20-,21-/m0/s1 |
| InChIKey | TVAAHBYPYBRBMC-ICTHYAOXSA-N |
| XLogP | 4.55 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |