C23H34O4 — CID 143111696
(6aS,7R,9R,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione;ethane (PubChem CID 143111696) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is (6aS,7R,9R,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione;ethane.
| Compound Name | (6aS,7R,9R,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione;ethane |
|---|---|
| PubChem CID | 143111696 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | (6aS,7R,9R,10bR)-2-(furan-3-yl)-6a,7,9,10b-tetramethyl-2,4a,5,6,7,8,9,10a-octahydro-1H-benzo[f]isochromene-4,10-dione;ethane |
| SMILES | CC.C[C@@H]1C[C@@H](C)[C@]2(C)CCC3C(=O)OC(c4ccoc4)C[C@]3(C)C2C1=O |
| InChI | InChI=1S/C21H28O4.C2H6/c1-12-9-13(2)20(3)7-5-15-19(23)25-16(14-6-8-24-11-14)10-21(15,4)18(20)17(12)22;1-2/h6,8,11-13,15-16,18H,5,7,9-10H2,1-4H3;1-2H3/t12-,13-,15?,16?,18?,20+,21+;/m1./s1 |
| InChIKey | BWADGPLHGGEUFT-WHGHXQCISA-N |
| XLogP | 5.58 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |