C21H26O5 — CID 143111717
(6aR,10S,10bR)-7-acetyl-2-(furan-3-yl)-10-hydroxy-6a,10b-dimethyl-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-4-one (PubChem CID 143111717) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (6aR,10S,10bR)-7-acetyl-2-(furan-3-yl)-10-hydroxy-6a,10b-dimethyl-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-4-one.
| Compound Name | (6aR,10S,10bR)-7-acetyl-2-(furan-3-yl)-10-hydroxy-6a,10b-dimethyl-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-4-one |
|---|---|
| PubChem CID | 143111717 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (6aR,10S,10bR)-7-acetyl-2-(furan-3-yl)-10-hydroxy-6a,10b-dimethyl-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-4-one |
| SMILES | CC(=O)C1=CCC(O)C2[C@@]3(C)CC(c4ccoc4)OC(=O)C3CC[C@@]12C |
| InChI | InChI=1S/C21H26O5/c1-12(22)14-4-5-16(23)18-20(14,2)8-6-15-19(24)26-17(10-21(15,18)3)13-7-9-25-11-13/h4,7,9,11,15-18,23H,5-6,8,10H2,1-3H3/t15?,16?,17?,18?,20-,21-/m0/s1 |
| InChIKey | LSLSNRUDESLIAS-XZFNAKAKSA-N |
| XLogP | 3.59 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |