C20H23F3O6S — CID 11419498
[(2R,4aR,6aR,10aR,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-4-oxo-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-7-yl] trifluoromethanesulfonate (PubChem CID 11419498) has the molecular formula C20H23F3O6S and a molecular weight of 448.46 g/mol. Its IUPAC name is [(2R,4aR,6aR,10aR,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-4-oxo-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-7-yl] trifluoromethanesulfonate.
| Compound Name | [(2R,4aR,6aR,10aR,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-4-oxo-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-7-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11419498 |
| Molecular Formula | C20H23F3O6S |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [(2R,4aR,6aR,10aR,10bR)-2-(furan-3-yl)-6a,10b-dimethyl-4-oxo-1,2,4a,5,6,9,10,10a-octahydrobenzo[f]isochromen-7-yl] trifluoromethanesulfonate |
| SMILES | C[C@]12C[C@H](c3ccoc3)OC(=O)[C@@H]1CC[C@@]1(C)C(OS(=O)(=O)C(F)(F)F)=CCC[C@H]21 |
| InChI | InChI=1S/C20H23F3O6S/c1-18-8-6-13-17(24)28-14(12-7-9-27-11-12)10-19(13,2)15(18)4-3-5-16(18)29-30(25,26)20(21,22)23/h5,7,9,11,13-15H,3-4,6,8,10H2,1-2H3/t13-,14+,15-,18+,19-/m0/s1 |
| InChIKey | ZWNXNOJVJYMXHI-XMMKGJGBSA-N |
| XLogP | 4.85 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|