C20H28O6 — CID 162852044
(3R,4R,4aS,5'R,7R,8R,8aR)-5'-(furan-3-yl)-3,4,8a-trihydroxy-4,4a,7-trimethylspiro[1,2,3,5,6,7-hexahydronaphthalene-8,3'-oxolane]-2'-one (PubChem CID 162852044) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is (3R,4R,4aS,5'R,7R,8R,8aR)-5'-(furan-3-yl)-3,4,8a-trihydroxy-4,4a,7-trimethylspiro[1,2,3,5,6,7-hexahydronaphthalene-8,3'-oxolane]-2'-one.
| Compound Name | (3R,4R,4aS,5'R,7R,8R,8aR)-5'-(furan-3-yl)-3,4,8a-trihydroxy-4,4a,7-trimethylspiro[1,2,3,5,6,7-hexahydronaphthalene-8,3'-oxolane]-2'-one |
|---|---|
| PubChem CID | 162852044 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3R,4R,4aS,5'R,7R,8R,8aR)-5'-(furan-3-yl)-3,4,8a-trihydroxy-4,4a,7-trimethylspiro[1,2,3,5,6,7-hexahydronaphthalene-8,3'-oxolane]-2'-one |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@](O)(CC[C@@H](O)[C@]2(C)O)[C@@]12C[C@H](c1ccoc1)OC2=O |
| InChI | InChI=1S/C20H28O6/c1-12-4-7-17(2)18(3,23)15(21)5-8-20(17,24)19(12)10-14(26-16(19)22)13-6-9-25-11-13/h6,9,11-12,14-15,21,23-24H,4-5,7-8,10H2,1-3H3/t12-,14-,15-,17-,18+,19+,20-/m1/s1 |
| InChIKey | QIAILSRHPLMWIP-RYDQSVKCSA-N |
| XLogP | 2.33 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |