C20H22O7 — CID 12011159
(5'S,6aS,7S,8S,10R,10aR)-5'-(furan-3-yl)-8,10-dihydroxy-8-methylspiro[1,5,6,6a,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione (PubChem CID 12011159) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (5'S,6aS,7S,8S,10R,10aR)-5'-(furan-3-yl)-8,10-dihydroxy-8-methylspiro[1,5,6,6a,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione.
| Compound Name | (5'S,6aS,7S,8S,10R,10aR)-5'-(furan-3-yl)-8,10-dihydroxy-8-methylspiro[1,5,6,6a,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 12011159 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (5'S,6aS,7S,8S,10R,10aR)-5'-(furan-3-yl)-8,10-dihydroxy-8-methylspiro[1,5,6,6a,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
| SMILES | C[C@]1(O)C[C@@H](O)[C@@]23COC(=O)C2=CCC[C@@H]3[C@@]12C[C@@H](c1ccoc1)OC2=O |
| InChI | InChI=1S/C20H22O7/c1-18(24)8-15(21)19-10-26-16(22)12(19)3-2-4-14(19)20(18)7-13(27-17(20)23)11-5-6-25-9-11/h3,5-6,9,13-15,21,24H,2,4,7-8,10H2,1H3/t13-,14-,15+,18-,19-,20+/m0/s1 |
| InChIKey | YBKBTNNWTRNMQL-LVNOUGRESA-N |
| XLogP | 1.65 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |