C20H20O5 — CID 162915943
(1S,7S,9R,10R)-7-(furan-3-yl)-9-methyl-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadeca-4,13-diene-3,15-dione (PubChem CID 162915943) has the molecular formula C20H20O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is (1S,7S,9R,10R)-7-(furan-3-yl)-9-methyl-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadeca-4,13-diene-3,15-dione.
| Compound Name | (1S,7S,9R,10R)-7-(furan-3-yl)-9-methyl-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadeca-4,13-diene-3,15-dione |
|---|---|
| PubChem CID | 162915943 |
| Molecular Formula | C20H20O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1S,7S,9R,10R)-7-(furan-3-yl)-9-methyl-6,16-dioxatetracyclo[8.7.0.01,14.04,9]heptadeca-4,13-diene-3,15-dione |
| SMILES | C[C@]12C[C@@H](c3ccoc3)OC=C1C(=O)C[C@@]13COC(=O)C1=CCC[C@@H]32 |
| InChI | InChI=1S/C20H20O5/c1-19-8-16(12-5-6-23-9-12)24-10-14(19)15(21)7-20-11-25-18(22)13(20)3-2-4-17(19)20/h3,5-6,9-10,16-17H,2,4,7-8,11H2,1H3/t16-,17+,19-,20+/m0/s1 |
| InChIKey | JSJGGYMCEWCMES-KVPLUYHFSA-N |
| XLogP | 3.48 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |