C22H24O6 — CID 101262485
(5'S,6aS,7R,8R,10R,10aR)-10-acetyl-5'-(furan-3-yl)-8-methylspiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione (PubChem CID 101262485) has the molecular formula C22H24O6 and a molecular weight of 384.43 g/mol. Its IUPAC name is (5'S,6aS,7R,8R,10R,10aR)-10-acetyl-5'-(furan-3-yl)-8-methylspiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione.
| Compound Name | (5'S,6aS,7R,8R,10R,10aR)-10-acetyl-5'-(furan-3-yl)-8-methylspiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 101262485 |
| Molecular Formula | C22H24O6 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (5'S,6aS,7R,8R,10R,10aR)-10-acetyl-5'-(furan-3-yl)-8-methylspiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
| SMILES | CC(=O)[C@@H]1C[C@@H](C)[C@]2(C[C@@H](c3ccoc3)OC2=O)[C@H]2CCC=C3C(=O)OC[C@]321 |
| InChI | InChI=1S/C22H24O6/c1-12-8-16(13(2)23)22-11-27-19(24)15(22)4-3-5-18(22)21(12)9-17(28-20(21)25)14-6-7-26-10-14/h4,6-7,10,12,16-18H,3,5,8-9,11H2,1-2H3/t12-,16+,17+,18-,21-,22-/m1/s1 |
| InChIKey | PDEINAKKZABGIZ-OJINZAOPSA-N |
| XLogP | 3.38 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |