C22H24O7 — CID 162902846
[5'-(furan-3-yl)-8-methyl-2',3-dioxospiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-10-yl] acetate (PubChem CID 162902846) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is [5'-(furan-3-yl)-8-methyl-2',3-dioxospiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-10-yl] acetate.
| Compound Name | [5'-(furan-3-yl)-8-methyl-2',3-dioxospiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-10-yl] acetate |
|---|---|
| PubChem CID | 162902846 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | [5'-(furan-3-yl)-8-methyl-2',3-dioxospiro[5,6,6a,8,9,10-hexahydro-1H-benzo[d][2]benzofuran-7,3'-oxolane]-10-yl] acetate |
| SMILES | CC(=O)OC1CC(C)C2(CC(c3ccoc3)OC2=O)C2CCC=C3C(=O)OCC312 |
| InChI | InChI=1S/C22H24O7/c1-12-8-18(28-13(2)23)22-11-27-19(24)15(22)4-3-5-17(22)21(12)9-16(29-20(21)25)14-6-7-26-10-14/h4,6-7,10,12,16-18H,3,5,8-9,11H2,1-2H3 |
| InChIKey | LAFKXZZHVGUAIC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|