C26H32O10 — CID 11145571
CID 11145571 (PubChem CID 11145571) has the molecular formula C26H32O10 and a molecular weight of 504.53 g/mol.
| Compound Name | CID 11145571 |
|---|---|
| PubChem CID | 11145571 |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.53 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@@]12[C@@H](OC(C)=O)C[C@@H](C)[C@]3(C[C@@H](c4ccoc4)OC3=O)[C@H]1CC[C@H](OC(C)=O)[C@]21CO1 |
| InChI | InChI=1S/C26H32O10/c1-14-9-22(35-17(4)29)25(12-32-15(2)27)20(5-6-21(34-16(3)28)26(25)13-33-26)24(14)10-19(36-23(24)30)18-7-8-31-11-18/h7-8,11,14,19-22H,5-6,9-10,12-13H2,1-4H3/t14-,19+,20-,21+,22+,24-,25+,26-/m1/s1 |
| InChIKey | RCVVNRBNRKRZGL-IUIARGKJSA-N |
| XLogP | 2.89 |
| TPSA | 130.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|