C24H30O9 — CID 162960872
CID 162960872 (PubChem CID 162960872) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol.
| Compound Name | CID 162960872 |
|---|---|
| PubChem CID | 162960872 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@@]12[C@H](OC(C)=O)[C@@H](O)[C@@H](C)[C@]3(C[C@@H](c4ccoc4)OC3=O)[C@H]1CCC[C@]21CO1 |
| InChI | InChI=1S/C24H30O9/c1-13-19(27)20(32-15(3)26)24(12-30-14(2)25)18(5-4-7-22(24)11-31-22)23(13)9-17(33-21(23)28)16-6-8-29-10-16/h6,8,10,13,17-20,27H,4-5,7,9,11-12H2,1-3H3/t13-,17+,18-,19+,20-,22+,23-,24+/m1/s1 |
| InChIKey | XJTLGPGBTUJJFW-WWWBXXGWSA-N |
| XLogP | 2.31 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|