C22H25ClO9 — CID 162937875
[(4S,4aS,5'S,6R,7S,8S,8aS)-4-(chloromethyl)-5'-(furan-3-yl)-4,6-dihydroxy-7-methyl-2',3,5-trioxospiro[2,6,7,8a-tetrahydro-1H-naphthalene-8,3'-oxolane]-4a-yl]methyl acetate (PubChem CID 162937875) has the molecular formula C22H25ClO9 and a molecular weight of 468.89 g/mol. Its IUPAC name is [(4S,4aS,5'S,6R,7S,8S,8aS)-4-(chloromethyl)-5'-(furan-3-yl)-4,6-dihydroxy-7-methyl-2',3,5-trioxospiro[2,6,7,8a-tetrahydro-1H-naphthalene-8,3'-oxolane]-4a-yl]methyl acetate.
| Compound Name | [(4S,4aS,5'S,6R,7S,8S,8aS)-4-(chloromethyl)-5'-(furan-3-yl)-4,6-dihydroxy-7-methyl-2',3,5-trioxospiro[2,6,7,8a-tetrahydro-1H-naphthalene-8,3'-oxolane]-4a-yl]methyl acetate |
|---|---|
| PubChem CID | 162937875 |
| Molecular Formula | C22H25ClO9 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | [(4S,4aS,5'S,6R,7S,8S,8aS)-4-(chloromethyl)-5'-(furan-3-yl)-4,6-dihydroxy-7-methyl-2',3,5-trioxospiro[2,6,7,8a-tetrahydro-1H-naphthalene-8,3'-oxolane]-4a-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C(=O)[C@H](O)[C@@H](C)[C@]3(C[C@@H](c4ccoc4)OC3=O)[C@H]1CCC(=O)[C@]2(O)CCl |
| InChI | InChI=1S/C22H25ClO9/c1-11-17(26)18(27)21(10-31-12(2)24)15(3-4-16(25)22(21,29)9-23)20(11)7-14(32-19(20)28)13-5-6-30-8-13/h5-6,8,11,14-15,17,26,29H,3-4,7,9-10H2,1-2H3/t11-,14+,15-,17-,20-,21+,22-/m1/s1 |
| InChIKey | MOTQKGQROGKJJP-ZNDGPWFTSA-N |
| XLogP | 1.33 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|