C20H27ClO7 — CID 163047909
1-(chloromethyl)-5'-(furan-3-yl)-1,2',8-trihydroxy-8a-(hydroxymethyl)-6-methylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2-one (PubChem CID 163047909) has the molecular formula C20H27ClO7 and a molecular weight of 414.88 g/mol. Its IUPAC name is 1-(chloromethyl)-5'-(furan-3-yl)-1,2',8-trihydroxy-8a-(hydroxymethyl)-6-methylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2-one.
| Compound Name | 1-(chloromethyl)-5'-(furan-3-yl)-1,2',8-trihydroxy-8a-(hydroxymethyl)-6-methylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2-one |
|---|---|
| PubChem CID | 163047909 |
| Molecular Formula | C20H27ClO7 |
| Molecular Weight | 414.88 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 1-(chloromethyl)-5'-(furan-3-yl)-1,2',8-trihydroxy-8a-(hydroxymethyl)-6-methylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2-one |
| SMILES | CC1CC(O)C2(CO)C(CCC(=O)C2(O)CCl)C12CC(c1ccoc1)OC2O |
| InChI | InChI=1S/C20H27ClO7/c1-11-6-16(24)19(10-22)14(2-3-15(23)20(19,26)9-21)18(11)7-13(28-17(18)25)12-4-5-27-8-12/h4-5,8,11,13-14,16-17,22,24-26H,2-3,6-7,9-10H2,1H3 |
| InChIKey | BANUAIXXNPGYQT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.88 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|