C20H23ClO8 — CID 163029132
(2R,3S,4R,4aS,5'S,8S,8aS)-8-(chloromethyl)-5'-(furan-3-yl)-2,8-dihydroxy-8a-(hydroxymethyl)-3-methylspiro[3,4a,5,6-tetrahydro-2H-naphthalene-4,3'-oxolane]-1,2',7-trione (PubChem CID 163029132) has the molecular formula C20H23ClO8 and a molecular weight of 426.85 g/mol. Its IUPAC name is (2R,3S,4R,4aS,5'S,8S,8aS)-8-(chloromethyl)-5'-(furan-3-yl)-2,8-dihydroxy-8a-(hydroxymethyl)-3-methylspiro[3,4a,5,6-tetrahydro-2H-naphthalene-4,3'-oxolane]-1,2',7-trione.
| Compound Name | (2R,3S,4R,4aS,5'S,8S,8aS)-8-(chloromethyl)-5'-(furan-3-yl)-2,8-dihydroxy-8a-(hydroxymethyl)-3-methylspiro[3,4a,5,6-tetrahydro-2H-naphthalene-4,3'-oxolane]-1,2',7-trione |
|---|---|
| PubChem CID | 163029132 |
| Molecular Formula | C20H23ClO8 |
| Molecular Weight | 426.85 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (2R,3S,4R,4aS,5'S,8S,8aS)-8-(chloromethyl)-5'-(furan-3-yl)-2,8-dihydroxy-8a-(hydroxymethyl)-3-methylspiro[3,4a,5,6-tetrahydro-2H-naphthalene-4,3'-oxolane]-1,2',7-trione |
| SMILES | C[C@@H]1[C@@H](O)C(=O)[C@]2(CO)[C@H](CCC(=O)[C@]2(O)CCl)[C@]12C[C@@H](c1ccoc1)OC2=O |
| InChI | InChI=1S/C20H23ClO8/c1-10-15(24)16(25)19(9-22)13(2-3-14(23)20(19,27)8-21)18(10)6-12(29-17(18)26)11-4-5-28-7-11/h4-5,7,10,12-13,15,22,24,27H,2-3,6,8-9H2,1H3/t10-,12+,13-,15-,18+,19+,20-/m1/s1 |
| InChIKey | BLJOIYBRNIDROH-DZJDGFLBSA-N |
| XLogP | 0.76 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.85 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|