C19H22O4 — CID 165413755
(4aS,5R,5'S,6R)-5'-(furan-3-yl)-1,6-dimethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2,2'-dione (PubChem CID 165413755) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is (4aS,5R,5'S,6R)-5'-(furan-3-yl)-1,6-dimethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2,2'-dione.
| Compound Name | (4aS,5R,5'S,6R)-5'-(furan-3-yl)-1,6-dimethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 165413755 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (4aS,5R,5'S,6R)-5'-(furan-3-yl)-1,6-dimethylspiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-2,2'-dione |
| SMILES | CC1=C2CC[C@@H](C)[C@]3(C[C@@H](c4ccoc4)OC3=O)[C@H]2CCC1=O |
| InChI | InChI=1S/C19H22O4/c1-11-3-4-14-12(2)16(20)6-5-15(14)19(11)9-17(23-18(19)21)13-7-8-22-10-13/h7-8,10-11,15,17H,3-6,9H2,1-2H3/t11-,15+,17+,19-/m1/s1 |
| InChIKey | ZJPWVKOAPYFBMD-DEZHIDQISA-N |
| XLogP | 3.98 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |