C18H20O4 — CID 53474774
(3R,4R,5'S)-5'-(furan-3-yl)-3-methylspiro[2,3,5,6,7,8-hexahydronaphthalene-4,3'-oxolane]-1,2'-dione (PubChem CID 53474774) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is (3R,4R,5'S)-5'-(furan-3-yl)-3-methylspiro[2,3,5,6,7,8-hexahydronaphthalene-4,3'-oxolane]-1,2'-dione.
| Compound Name | (3R,4R,5'S)-5'-(furan-3-yl)-3-methylspiro[2,3,5,6,7,8-hexahydronaphthalene-4,3'-oxolane]-1,2'-dione |
|---|---|
| PubChem CID | 53474774 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3R,4R,5'S)-5'-(furan-3-yl)-3-methylspiro[2,3,5,6,7,8-hexahydronaphthalene-4,3'-oxolane]-1,2'-dione |
| SMILES | C[C@@H]1CC(=O)C2=C(CCCC2)[C@@]12C[C@@H](c1ccoc1)OC2=O |
| InChI | InChI=1S/C18H20O4/c1-11-8-15(19)13-4-2-3-5-14(13)18(11)9-16(22-17(18)20)12-6-7-21-10-12/h6-7,10-11,16H,2-5,8-9H2,1H3/t11-,16+,18-/m1/s1 |
| InChIKey | VGYJGCMTDFUNCY-DPZKZMLUSA-N |
| XLogP | 3.73 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |