C24H28O9 — CID 163083887
dimethyl 8-acetyloxy-5'-(furan-3-yl)-6-methyl-2'-oxospiro[2,3,4,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,1-dicarboxylate (PubChem CID 163083887) has the molecular formula C24H28O9 and a molecular weight of 460.48 g/mol. Its IUPAC name is dimethyl 8-acetyloxy-5'-(furan-3-yl)-6-methyl-2'-oxospiro[2,3,4,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,1-dicarboxylate.
| Compound Name | dimethyl 8-acetyloxy-5'-(furan-3-yl)-6-methyl-2'-oxospiro[2,3,4,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,1-dicarboxylate |
|---|---|
| PubChem CID | 163083887 |
| Molecular Formula | C24H28O9 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | dimethyl 8-acetyloxy-5'-(furan-3-yl)-6-methyl-2'-oxospiro[2,3,4,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCCC2=C1C(OC(C)=O)CC(C)C21CC(c2ccoc2)OC1=O |
| InChI | InChI=1S/C24H28O9/c1-13-10-17(32-14(2)25)19-16(6-5-8-23(19,20(26)29-3)21(27)30-4)24(13)11-18(33-22(24)28)15-7-9-31-12-15/h7,9,12-13,17-18H,5-6,8,10-11H2,1-4H3 |
| InChIKey | HNKVZWMTWXMQLZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|