C24H28O10 — CID 51692856
dimethyl (1S,2S,4aR,5S,5'R,8aR)-2-acetyloxy-5'-(furan-3-yl)-1-hydroxy-6-methyl-2'-oxospiro[3,4,4a,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-1,8a-dicarboxylate (PubChem CID 51692856) has the molecular formula C24H28O10 and a molecular weight of 476.48 g/mol. Its IUPAC name is dimethyl (1S,2S,4aR,5S,5'R,8aR)-2-acetyloxy-5'-(furan-3-yl)-1-hydroxy-6-methyl-2'-oxospiro[3,4,4a,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-1,8a-dicarboxylate.
| Compound Name | dimethyl (1S,2S,4aR,5S,5'R,8aR)-2-acetyloxy-5'-(furan-3-yl)-1-hydroxy-6-methyl-2'-oxospiro[3,4,4a,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-1,8a-dicarboxylate |
|---|---|
| PubChem CID | 51692856 |
| Molecular Formula | C24H28O10 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | dimethyl (1S,2S,4aR,5S,5'R,8aR)-2-acetyloxy-5'-(furan-3-yl)-1-hydroxy-6-methyl-2'-oxospiro[3,4,4a,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-1,8a-dicarboxylate |
| SMILES | COC(=O)[C@@]1(O)[C@@H](OC(C)=O)CC[C@@H]2[C@@]3(C[C@H](c4ccoc4)OC3=O)C(C)=CC[C@@]21C(=O)OC |
| InChI | InChI=1S/C24H28O10/c1-13-7-9-23(20(27)30-3)17(5-6-18(33-14(2)25)24(23,29)21(28)31-4)22(13)11-16(34-19(22)26)15-8-10-32-12-15/h7-8,10,12,16-18,29H,5-6,9,11H2,1-4H3/t16-,17-,18+,22-,23+,24+/m1/s1 |
| InChIKey | NOSUBWMAOPEEBW-WYUAZEKHSA-N |
| XLogP | 2.01 |
| TPSA | 138.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|