C22H30O8 — CID 162865620
[(1R,2R,4aR,5R,5'R,6S,8aS)-5'-(furan-3-yl)-1,4a,6-trihydroxy-1,6,8a-trimethyl-2'-oxospiro[3,4,7,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-2-yl] acetate (PubChem CID 162865620) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is [(1R,2R,4aR,5R,5'R,6S,8aS)-5'-(furan-3-yl)-1,4a,6-trihydroxy-1,6,8a-trimethyl-2'-oxospiro[3,4,7,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-2-yl] acetate.
| Compound Name | [(1R,2R,4aR,5R,5'R,6S,8aS)-5'-(furan-3-yl)-1,4a,6-trihydroxy-1,6,8a-trimethyl-2'-oxospiro[3,4,7,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-2-yl] acetate |
|---|---|
| PubChem CID | 162865620 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(1R,2R,4aR,5R,5'R,6S,8aS)-5'-(furan-3-yl)-1,4a,6-trihydroxy-1,6,8a-trimethyl-2'-oxospiro[3,4,7,8-tetrahydro-2H-naphthalene-5,3'-oxolane]-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(O)[C@](C)(CC[C@](C)(O)[C@]23C[C@H](c2ccoc2)OC3=O)[C@@]1(C)O |
| InChI | InChI=1S/C22H30O8/c1-13(23)29-16-5-7-22(27)18(2,20(16,4)26)8-9-19(3,25)21(22)11-15(30-17(21)24)14-6-10-28-12-14/h6,10,12,15-16,25-27H,5,7-9,11H2,1-4H3/t15-,16-,18-,19+,20+,21-,22-/m1/s1 |
| InChIKey | HGPQPFZWIPAIND-AVRKARDMSA-N |
| XLogP | 2.01 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |