C20H24O6 — CID 14707184
(1S,2R,3S,5'R,6R,7R)-5'-(furan-3-yl)-3-hydroxy-3,6,7-trimethylspiro[9-oxatricyclo[5.2.2.01,6]undecane-2,3'-oxolane]-2',8-dione (PubChem CID 14707184) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1S,2R,3S,5'R,6R,7R)-5'-(furan-3-yl)-3-hydroxy-3,6,7-trimethylspiro[9-oxatricyclo[5.2.2.01,6]undecane-2,3'-oxolane]-2',8-dione.
| Compound Name | (1S,2R,3S,5'R,6R,7R)-5'-(furan-3-yl)-3-hydroxy-3,6,7-trimethylspiro[9-oxatricyclo[5.2.2.01,6]undecane-2,3'-oxolane]-2',8-dione |
|---|---|
| PubChem CID | 14707184 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1S,2R,3S,5'R,6R,7R)-5'-(furan-3-yl)-3-hydroxy-3,6,7-trimethylspiro[9-oxatricyclo[5.2.2.01,6]undecane-2,3'-oxolane]-2',8-dione |
| SMILES | C[C@]12CC[C@](C)(O)[C@]3(C[C@H](c4ccoc4)OC3=O)[C@]13CC[C@@]2(C)C(=O)O3 |
| InChI | InChI=1S/C20H24O6/c1-16-5-8-20(26-14(16)21)17(16,2)6-7-18(3,23)19(20)10-13(25-15(19)22)12-4-9-24-11-12/h4,9,11,13,23H,5-8,10H2,1-3H3/t13-,16+,17-,18+,19-,20+/m1/s1 |
| InChIKey | GXVJLBUSARFIRR-BHPSNQOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |