C21H26O9 — CID 163673951
methyl (4aR,9S,10R,10aR,10bR)-2-(furan-3-yl)-4a,9,10,10a-tetrahydroxy-6,10b-dimethyl-4-oxo-2,5,6,6a,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylate (PubChem CID 163673951) has the molecular formula C21H26O9 and a molecular weight of 422.43 g/mol. Its IUPAC name is methyl (4aR,9S,10R,10aR,10bR)-2-(furan-3-yl)-4a,9,10,10a-tetrahydroxy-6,10b-dimethyl-4-oxo-2,5,6,6a,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylate.
| Compound Name | methyl (4aR,9S,10R,10aR,10bR)-2-(furan-3-yl)-4a,9,10,10a-tetrahydroxy-6,10b-dimethyl-4-oxo-2,5,6,6a,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylate |
|---|---|
| PubChem CID | 163673951 |
| Molecular Formula | C21H26O9 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | methyl (4aR,9S,10R,10aR,10bR)-2-(furan-3-yl)-4a,9,10,10a-tetrahydroxy-6,10b-dimethyl-4-oxo-2,5,6,6a,9,10-hexahydro-1H-benzo[f]isochromene-7-carboxylate |
| SMILES | COC(=O)C1=C[C@H](O)[C@@H](O)[C@@]2(O)C1C(C)C[C@]1(O)C(=O)OC(c3ccoc3)C[C@@]12C |
| InChI | InChI=1S/C21H26O9/c1-10-7-20(26)18(25)30-14(11-4-5-29-9-11)8-19(20,2)21(27)15(10)12(17(24)28-3)6-13(22)16(21)23/h4-6,9-10,13-16,22-23,26-27H,7-8H2,1-3H3/t10?,13-,14?,15?,16+,19-,20-,21-/m0/s1 |
| InChIKey | JEZRITYWFIUJHD-LYCHQAJGSA-N |
| XLogP | 0.23 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |