C22H26O7 — CID 74135932
dimethyl 5'-(furan-3-yl)-6-methyl-2'-oxospiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,8a-dicarboxylate (PubChem CID 74135932) has the molecular formula C22H26O7 and a molecular weight of 402.44 g/mol. Its IUPAC name is dimethyl 5'-(furan-3-yl)-6-methyl-2'-oxospiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,8a-dicarboxylate.
| Compound Name | dimethyl 5'-(furan-3-yl)-6-methyl-2'-oxospiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,8a-dicarboxylate |
|---|---|
| PubChem CID | 74135932 |
| Molecular Formula | C22H26O7 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | dimethyl 5'-(furan-3-yl)-6-methyl-2'-oxospiro[3,4,4a,6,7,8-hexahydronaphthalene-5,3'-oxolane]-1,8a-dicarboxylate |
| SMILES | COC(=O)C1=CCCC2C1(C(=O)OC)CCC(C)C21CC(c2ccoc2)OC1=O |
| InChI | InChI=1S/C22H26O7/c1-13-7-9-21(19(24)27-3)15(18(23)26-2)5-4-6-17(21)22(13)11-16(29-20(22)25)14-8-10-28-12-14/h5,8,10,12-13,16-17H,4,6-7,9,11H2,1-3H3 |
| InChIKey | AUFQZNLYPNBSRV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|