C22H24O7 — CID 162872798
dimethyl 2'-(furan-3-yl)-4a,6-dimethyl-4'-oxospiro[7,8-dihydro-6H-naphthalene-5,3'-oxetane]-1,8a-dicarboxylate (PubChem CID 162872798) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is dimethyl 2'-(furan-3-yl)-4a,6-dimethyl-4'-oxospiro[7,8-dihydro-6H-naphthalene-5,3'-oxetane]-1,8a-dicarboxylate.
| Compound Name | dimethyl 2'-(furan-3-yl)-4a,6-dimethyl-4'-oxospiro[7,8-dihydro-6H-naphthalene-5,3'-oxetane]-1,8a-dicarboxylate |
|---|---|
| PubChem CID | 162872798 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | dimethyl 2'-(furan-3-yl)-4a,6-dimethyl-4'-oxospiro[7,8-dihydro-6H-naphthalene-5,3'-oxetane]-1,8a-dicarboxylate |
| SMILES | COC(=O)C1=CC=CC2(C)C1(C(=O)OC)CCC(C)C21C(=O)OC1c1ccoc1 |
| InChI | InChI=1S/C22H24O7/c1-13-7-10-21(18(24)27-4)15(17(23)26-3)6-5-9-20(21,2)22(13)16(29-19(22)25)14-8-11-28-12-14/h5-6,8-9,11-13,16H,7,10H2,1-4H3 |
| InChIKey | YBEUGFIDXKKVDE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|